C17H18ClFIN2O2- — CID 163510336
N-(4-chloro-3-fluoroiodanuidylphenyl)-2-[2-(dimethylamino)ethoxy]benzamide (PubChem CID 163510336) has the molecular formula C17H18ClFIN2O2- and a molecular weight of 463.70 g/mol. Its IUPAC name is N-(4-chloro-3-fluoroiodanuidylphenyl)-2-[2-(dimethylamino)ethoxy]benzamide.
| Compound Name | N-(4-chloro-3-fluoroiodanuidylphenyl)-2-[2-(dimethylamino)ethoxy]benzamide |
|---|---|
| PubChem CID | 163510336 |
| Molecular Formula | C17H18ClFIN2O2- |
| Molecular Weight | 463.70 g/mol |
| Exact Mass | 463.01 |
| IUPAC Name | N-(4-chloro-3-fluoroiodanuidylphenyl)-2-[2-(dimethylamino)ethoxy]benzamide |
| SMILES | CN(C)CCOc1ccccc1C(=O)Nc1ccc(Cl)c([I-]F)c1 |
| InChI | InChI=1S/C17H18ClFIN2O2/c1-22(2)9-10-24-16-6-4-3-5-13(16)17(23)21-12-7-8-14(18)15(11-12)20-19/h3-8,11H,9-10H2,1-2H3,(H,21,23)/q-1 |
| InChIKey | WQJVUAFFHLIYAZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.70 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|