C5H7N2O3+ — CID 163510446
1-methyl-1,3-diazinan-3-ium-2,4,6-trione (PubChem CID 163510446) has the molecular formula C5H7N2O3+ and a molecular weight of 143.12 g/mol. Its IUPAC name is 1-methyl-1,3-diazinan-3-ium-2,4,6-trione.
| Compound Name | 1-methyl-1,3-diazinan-3-ium-2,4,6-trione |
|---|---|
| PubChem CID | 163510446 |
| Molecular Formula | C5H7N2O3+ |
| Molecular Weight | 143.12 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 1-methyl-1,3-diazinan-3-ium-2,4,6-trione |
| SMILES | CN1C(=O)CC(=O)[NH2+]C1=O |
| InChI | InChI=1S/C5H6N2O3/c1-7-4(9)2-3(8)6-5(7)10/h2H2,1H3,(H,6,8,10)/p+1 |
| InChIKey | DCGGMHIZEAHUJL-UHFFFAOYSA-O |
| XLogP | -1.94 |
| TPSA | 71.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.12 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|