About methyl 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonate
methyl 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonate (PubChem CID 163510887) has the molecular formula C7H7NO4S
and a molecular weight of 201.20 g/mol. Its IUPAC name is methyl 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonate.
Molecular Properties
| Compound Name | methyl 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonate |
| PubChem CID | 163510887 |
| Molecular Formula | C7H7NO4S |
| Molecular Weight | 201.20 g/mol |
| Exact Mass | 201.01 |
| IUPAC Name | methyl 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonate |
| SMILES | [H]/N=C1\C=C(S(=O)(=O)OC)C=CC1=O |
| InChI | InChI=1S/C7H7NO4S/c1-12-13(10,11)5-2-3-7(9)6(8)4-5/h2-4,8H,1H3/b8-6+ |
| InChIKey | DCOXCQBCVVIQHE-SOFGYWHQSA-N |
| XLogP | 0.01 |
| TPSA | 84.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.20 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonate?
The IUPAC name of methyl 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonate (CID 163510887) is methyl 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonate.
What is the SMILES notation for methyl 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonate?
The canonical SMILES for methyl 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonate is [H]/N=C1\C=C(S(=O)(=O)OC)C=CC1=O.
What is the InChIKey of methyl 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonate?
The InChIKey is DCOXCQBCVVIQHE-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H7NO4S/c1-12-13(10,11)5-2-3-7(9)6(8)4-5/h2-4,8H,1H3/b8-6+.
What are the key properties of methyl 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonate?
methyl 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonate has a molecular weight of 201.20 g/mol, XLogP of 0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-imino-4-oxocyclohexa-1,5-diene-1-sulfonate is sourced from PubChem (CID 163510887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).