About 4-acetamidocyclohexa-1,3-diene-1-sulfinate
4-acetamidocyclohexa-1,3-diene-1-sulfinate (PubChem CID 163511464) has the molecular formula C8H10NO3S-
and a molecular weight of 200.24 g/mol. Its IUPAC name is 4-acetamidocyclohexa-1,3-diene-1-sulfinate.
Molecular Properties
| Compound Name | 4-acetamidocyclohexa-1,3-diene-1-sulfinate |
| PubChem CID | 163511464 |
| Molecular Formula | C8H10NO3S- |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 4-acetamidocyclohexa-1,3-diene-1-sulfinate |
| SMILES | CC(=O)NC1=CC=C(S(=O)[O-])CC1 |
| InChI | InChI=1S/C8H11NO3S/c1-6(10)9-7-2-4-8(5-3-7)13(11)12/h2,4H,3,5H2,1H3,(H,9,10)(H,11,12)/p-1 |
| InChIKey | DJURWSBLLVZECA-UHFFFAOYSA-M |
| XLogP | 0.56 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4-acetamidocyclohexa-1,3-diene-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetamidocyclohexa-1,3-diene-1-sulfinate?
The IUPAC name of 4-acetamidocyclohexa-1,3-diene-1-sulfinate (CID 163511464) is 4-acetamidocyclohexa-1,3-diene-1-sulfinate.
What is the SMILES notation for 4-acetamidocyclohexa-1,3-diene-1-sulfinate?
The canonical SMILES for 4-acetamidocyclohexa-1,3-diene-1-sulfinate is CC(=O)NC1=CC=C(S(=O)[O-])CC1.
What is the InChIKey of 4-acetamidocyclohexa-1,3-diene-1-sulfinate?
The InChIKey is DJURWSBLLVZECA-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H11NO3S/c1-6(10)9-7-2-4-8(5-3-7)13(11)12/h2,4H,3,5H2,1H3,(H,9,10)(H,11,12)/p-1.
What are the key properties of 4-acetamidocyclohexa-1,3-diene-1-sulfinate?
4-acetamidocyclohexa-1,3-diene-1-sulfinate has a molecular weight of 200.24 g/mol, XLogP of 0.56, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetamidocyclohexa-1,3-diene-1-sulfinate is sourced from PubChem (CID 163511464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).