C53H73AlF2IN9O13- — CID 163511730
CID 163511730 (PubChem CID 163511730) has the molecular formula C53H73AlF2IN9O13- and a molecular weight of 1236.10 g/mol.
| Compound Name | CID 163511730 |
|---|---|
| PubChem CID | 163511730 |
| Molecular Formula | C53H73AlF2IN9O13- |
| Molecular Weight | 1236.10 g/mol |
| Exact Mass | 1235.42 |
| IUPAC Name | — |
| SMILES | CCC(CC)(CC(CC(=O)O)C(=O)NCC(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCN(C(=O)CO)[C@@H](c1cc(-c2cc(F)ccc2F)cn1Cc1ccccc1)C(C)(C)C)C(=O)NCCC(=O)N[C@H](CCC(N)=O)C(=O)O)[Al]C[IH-] |
| InChI | InChI=1S/C52H70F2N9O13.CH2I.Al/c1-6-30(7-2)21-32(23-46(70)71)48(72)58-26-44(68)60-39(25-42(56)66)50(74)61-37(49(73)57-19-17-43(67)59-38(51(75)76)15-16-41(55)65)18-20-63(45(69)29-64)47(52(3,4)5)40-22-33(35-24-34(53)13-14-36(35)54)28-62(40)27-31-11-9-8-10-12-31;1-2;/h8-14,22,24,28,32,37-39,47,64H,6-7,15-21,23,25-27,29H2,1-5H3,(H2,55,65)(H2,56,66)(H,57,73)(H,58,72)(H,59,67)(H,60,68)(H,61,74)(H,70,71)(H,75,76);1H2;/q;-1;/t32?,37-,38+,39-,47-;;/m0../s1 |
| InChIKey | VWZYIHMFYYNGAC-HGZBMKBHSA-N |
| XLogP | -1.51 |
| TPSA | 351.75 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 79 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1236.10 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|