About (Z)-3-amino-N'-[3-(azetidin-1-yl)-3-imino-1-(methylamino)prop-1-enyl]but-2-enimidamide
(Z)-3-amino-N'-[3-(azetidin-1-yl)-3-imino-1-(methylamino)prop-1-enyl]but-2-enimidamide (PubChem CID 163511950) has the molecular formula C11H20N6
and a molecular weight of 236.32 g/mol. Its IUPAC name is (Z)-3-amino-N'-[3-(azetidin-1-yl)-3-imino-1-(methylamino)prop-1-enyl]but-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-3-amino-N'-[3-(azetidin-1-yl)-3-imino-1-(methylamino)prop-1-enyl]but-2-enimidamide |
| PubChem CID | 163511950 |
| Molecular Formula | C11H20N6 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | (Z)-3-amino-N'-[3-(azetidin-1-yl)-3-imino-1-(methylamino)prop-1-enyl]but-2-enimidamide |
| SMILES | [H]/N=C(\C=C(N=C(N)/C=C(/C)N)NC)N1CCC1 |
| InChI | InChI=1S/C11H20N6/c1-8(12)6-9(13)16-11(15-2)7-10(14)17-4-3-5-17/h6-7,14-15H,3-5,12H2,1-2H3,(H2,13,16)/b8-6-,11-7?,14-10+ |
| InChIKey | PAQNYLAUYNWEIB-MAIHYMSVSA-N |
| XLogP | -0.05 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-amino-N'-[3-(azetidin-1-yl)-3-imino-1-(methylamino)prop-1-enyl]but-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-amino-N'-[3-(azetidin-1-yl)-3-imino-1-(methylamino)prop-1-enyl]but-2-enimidamide?
The IUPAC name of (Z)-3-amino-N'-[3-(azetidin-1-yl)-3-imino-1-(methylamino)prop-1-enyl]but-2-enimidamide (CID 163511950) is (Z)-3-amino-N'-[3-(azetidin-1-yl)-3-imino-1-(methylamino)prop-1-enyl]but-2-enimidamide.
What is the SMILES notation for (Z)-3-amino-N'-[3-(azetidin-1-yl)-3-imino-1-(methylamino)prop-1-enyl]but-2-enimidamide?
The canonical SMILES for (Z)-3-amino-N'-[3-(azetidin-1-yl)-3-imino-1-(methylamino)prop-1-enyl]but-2-enimidamide is [H]/N=C(\C=C(N=C(N)/C=C(/C)N)NC)N1CCC1.
What is the InChIKey of (Z)-3-amino-N'-[3-(azetidin-1-yl)-3-imino-1-(methylamino)prop-1-enyl]but-2-enimidamide?
The InChIKey is PAQNYLAUYNWEIB-MAIHYMSVSA-N. The full InChI is InChI=1S/C11H20N6/c1-8(12)6-9(13)16-11(15-2)7-10(14)17-4-3-5-17/h6-7,14-15H,3-5,12H2,1-2H3,(H2,13,16)/b8-6-,11-7?,14-10+.
What are the key properties of (Z)-3-amino-N'-[3-(azetidin-1-yl)-3-imino-1-(methylamino)prop-1-enyl]but-2-enimidamide?
(Z)-3-amino-N'-[3-(azetidin-1-yl)-3-imino-1-(methylamino)prop-1-enyl]but-2-enimidamide has a molecular weight of 236.32 g/mol, XLogP of -0.05, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-amino-N'-[3-(azetidin-1-yl)-3-imino-1-(methylamino)prop-1-enyl]but-2-enimidamide is sourced from PubChem (CID 163511950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).