C31H29F3N2O6S — CID 163512616
7-ethyl-2-(3-hydroxypropyl)-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid (PubChem CID 163512616) has the molecular formula C31H29F3N2O6S and a molecular weight of 614.64 g/mol. Its IUPAC name is 7-ethyl-2-(3-hydroxypropyl)-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid.
| Compound Name | 7-ethyl-2-(3-hydroxypropyl)-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid |
|---|---|
| PubChem CID | 163512616 |
| Molecular Formula | C31H29F3N2O6S |
| Molecular Weight | 614.64 g/mol |
| Exact Mass | 614.17 |
| IUPAC Name | 7-ethyl-2-(3-hydroxypropyl)-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylic acid |
| SMILES | CCc1c(Cc2cccc3ccccc23)c(-c2cccc(C(F)(F)F)c2)c2n(c1=O)C(C(=O)O)CN(CCCO)S2(=O)=O |
| InChI | InChI=1S/C31H29F3N2O6S/c1-2-23-25(17-20-10-5-9-19-8-3-4-13-24(19)20)27(21-11-6-12-22(16-21)31(32,33)34)29-36(28(23)38)26(30(39)40)18-35(14-7-15-37)43(29,41)42/h3-6,8-13,16,26,37H,2,7,14-15,17-18H2,1H3,(H,39,40) |
| InChIKey | DDYYEBPSYMUFBT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.64 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |