C13H19F3O3 — CID 163512672
(Z,8S)-1,1,1-trifluoro-8-methoxy-6,9-dimethyldec-6-ene-2,4-dione (PubChem CID 163512672) has the molecular formula C13H19F3O3 and a molecular weight of 280.29 g/mol. Its IUPAC name is (Z,8S)-1,1,1-trifluoro-8-methoxy-6,9-dimethyldec-6-ene-2,4-dione.
| Compound Name | (Z,8S)-1,1,1-trifluoro-8-methoxy-6,9-dimethyldec-6-ene-2,4-dione |
|---|---|
| PubChem CID | 163512672 |
| Molecular Formula | C13H19F3O3 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (Z,8S)-1,1,1-trifluoro-8-methoxy-6,9-dimethyldec-6-ene-2,4-dione |
| SMILES | CO[C@H](/C=C(/C)CC(=O)CC(=O)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C13H19F3O3/c1-8(2)11(19-4)6-9(3)5-10(17)7-12(18)13(14,15)16/h6,8,11H,5,7H2,1-4H3/b9-6-/t11-/m1/s1 |
| InChIKey | DEACSANQOGMQRB-DHHDDZJSSA-N |
| XLogP | 3.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|