C10H30N5O5+5 — CID 163513129
2,2,4,4,6,6,8,8,10,10-decamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentazecane-2,4,6,8,10-pentaium (PubChem CID 163513129) has the molecular formula C10H30N5O5+5 and a molecular weight of 300.38 g/mol. Its IUPAC name is 2,2,4,4,6,6,8,8,10,10-decamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentazecane-2,4,6,8,10-pentaium.
| Compound Name | 2,2,4,4,6,6,8,8,10,10-decamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentazecane-2,4,6,8,10-pentaium |
|---|---|
| PubChem CID | 163513129 |
| Molecular Formula | C10H30N5O5+5 |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 2,2,4,4,6,6,8,8,10,10-decamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentazecane-2,4,6,8,10-pentaium |
| SMILES | C[N+]1(C)O[N+](C)(C)O[N+](C)(C)O[N+](C)(C)O[N+](C)(C)O1 |
| InChI | InChI=1S/C10H30N5O5/c1-11(2)16-12(3,4)18-14(7,8)20-15(9,10)19-13(5,6)17-11/h1-10H3/q+5 |
| InChIKey | FAAYMDJQCJJAJU-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|