C27H36N4O — CID 163513539
1-[[5-(4-aminophenyl)-3-(2-cyclohexylethyl)pyrazin-2-yl]amino]-3-cyclohexa-1,5-dien-1-ylpropan-1-ol (PubChem CID 163513539) has the molecular formula C27H36N4O and a molecular weight of 432.61 g/mol. Its IUPAC name is 1-[[5-(4-aminophenyl)-3-(2-cyclohexylethyl)pyrazin-2-yl]amino]-3-cyclohexa-1,5-dien-1-ylpropan-1-ol.
| Compound Name | 1-[[5-(4-aminophenyl)-3-(2-cyclohexylethyl)pyrazin-2-yl]amino]-3-cyclohexa-1,5-dien-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 163513539 |
| Molecular Formula | C27H36N4O |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | 1-[[5-(4-aminophenyl)-3-(2-cyclohexylethyl)pyrazin-2-yl]amino]-3-cyclohexa-1,5-dien-1-ylpropan-1-ol |
| SMILES | Nc1ccc(-c2cnc(NC(O)CCC3=CCCC=C3)c(CCC3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C27H36N4O/c28-23-15-13-22(14-16-23)25-19-29-27(24(30-25)17-11-20-7-3-1-4-8-20)31-26(32)18-12-21-9-5-2-6-10-21/h5,9-10,13-16,19-20,26,32H,1-4,6-8,11-12,17-18,28H2,(H,29,31) |
| InChIKey | DETRBHJHJJPJBA-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|