C28H20F4 — CID 163513572
(5E)-5-[4-[4-(4-but-3-enylidenecyclohexa-2,5-dien-1-ylidene)cyclohexa-2,5-dien-1-ylidene]-2-fluorocyclohexa-2,5-dien-1-ylidene]-1,2,3-trifluorocyclohexa-1,3-diene (PubChem CID 163513572) has the molecular formula C28H20F4 and a molecular weight of 432.46 g/mol. Its IUPAC name is (5E)-5-[4-[4-(4-but-3-enylidenecyclohexa-2,5-dien-1-ylidene)cyclohexa-2,5-dien-1-ylidene]-2-fluorocyclohexa-2,5-dien-1-ylidene]-1,2,3-trifluorocyclohexa-1,3-diene.
| Compound Name | (5E)-5-[4-[4-(4-but-3-enylidenecyclohexa-2,5-dien-1-ylidene)cyclohexa-2,5-dien-1-ylidene]-2-fluorocyclohexa-2,5-dien-1-ylidene]-1,2,3-trifluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 163513572 |
| Molecular Formula | C28H20F4 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | (5E)-5-[4-[4-(4-but-3-enylidenecyclohexa-2,5-dien-1-ylidene)cyclohexa-2,5-dien-1-ylidene]-2-fluorocyclohexa-2,5-dien-1-ylidene]-1,2,3-trifluorocyclohexa-1,3-diene |
| SMILES | C=CCC=c1ccc(=c2ccc(=c3cc/c(=C4\C=C(F)C(F)=C(F)C4)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C28H20F4/c1-2-3-4-18-5-7-19(8-6-18)20-9-11-21(12-10-20)22-13-14-24(25(29)15-22)23-16-26(30)28(32)27(31)17-23/h2,4-16H,1,3,17H2/b18-4-,20-19-,22-21-,24-23- |
| InChIKey | DEUBLRMTRVWWCD-FHCVFTFPSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|