About 4,5-dimethyl-1-oxo-1,2-thiazol-3-amine
4,5-dimethyl-1-oxo-1,2-thiazol-3-amine (PubChem CID 163514047) has the molecular formula C5H8N2OS
and a molecular weight of 144.20 g/mol. Its IUPAC name is 4,5-dimethyl-1-oxo-1,2-thiazol-3-amine.
Molecular Properties
| Compound Name | 4,5-dimethyl-1-oxo-1,2-thiazol-3-amine |
| PubChem CID | 163514047 |
| Molecular Formula | C5H8N2OS |
| Molecular Weight | 144.20 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 4,5-dimethyl-1-oxo-1,2-thiazol-3-amine |
| SMILES | CC1=C(C)S(=O)N=C1N |
| InChI | InChI=1S/C5H8N2OS/c1-3-4(2)9(8)7-5(3)6/h1-2H3,(H2,6,7) |
| InChIKey | DFEFJWBOFQCACG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.20 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dimethyl-1-oxo-1,2-thiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-1-oxo-1,2-thiazol-3-amine?
The IUPAC name of 4,5-dimethyl-1-oxo-1,2-thiazol-3-amine (CID 163514047) is 4,5-dimethyl-1-oxo-1,2-thiazol-3-amine.
What is the SMILES notation for 4,5-dimethyl-1-oxo-1,2-thiazol-3-amine?
The canonical SMILES for 4,5-dimethyl-1-oxo-1,2-thiazol-3-amine is CC1=C(C)S(=O)N=C1N.
What is the InChIKey of 4,5-dimethyl-1-oxo-1,2-thiazol-3-amine?
The InChIKey is DFEFJWBOFQCACG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2OS/c1-3-4(2)9(8)7-5(3)6/h1-2H3,(H2,6,7).
What are the key properties of 4,5-dimethyl-1-oxo-1,2-thiazol-3-amine?
4,5-dimethyl-1-oxo-1,2-thiazol-3-amine has a molecular weight of 144.20 g/mol, XLogP of 0.31, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-1-oxo-1,2-thiazol-3-amine is sourced from PubChem (CID 163514047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).