About pyridin-4-yl-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanol
pyridin-4-yl-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanol (PubChem CID 163515042) has the molecular formula C11H10F3N3O
and a molecular weight of 257.22 g/mol. Its IUPAC name is pyridin-4-yl-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanol.
Molecular Properties
| Compound Name | pyridin-4-yl-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanol |
| PubChem CID | 163515042 |
| Molecular Formula | C11H10F3N3O |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | pyridin-4-yl-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanol |
| SMILES | OC(c1ccncc1)c1ccn(CC(F)(F)F)n1 |
| InChI | InChI=1S/C11H10F3N3O/c12-11(13,14)7-17-6-3-9(16-17)10(18)8-1-4-15-5-2-8/h1-6,10,18H,7H2 |
| InChIKey | DFYRLUWBQSBARL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridin-4-yl-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-4-yl-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanol?
The IUPAC name of pyridin-4-yl-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanol (CID 163515042) is pyridin-4-yl-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanol.
What is the SMILES notation for pyridin-4-yl-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanol?
The canonical SMILES for pyridin-4-yl-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanol is OC(c1ccncc1)c1ccn(CC(F)(F)F)n1.
What is the InChIKey of pyridin-4-yl-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanol?
The InChIKey is DFYRLUWBQSBARL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3N3O/c12-11(13,14)7-17-6-3-9(16-17)10(18)8-1-4-15-5-2-8/h1-6,10,18H,7H2.
What are the key properties of pyridin-4-yl-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanol?
pyridin-4-yl-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanol has a molecular weight of 257.22 g/mol, XLogP of 1.92, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-4-yl-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]methanol is sourced from PubChem (CID 163515042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).