About S-pentyl 2-[(4R)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]ethanethioate
S-pentyl 2-[(4R)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]ethanethioate (PubChem CID 163515140) has the molecular formula C12H20O4S
and a molecular weight of 260.35 g/mol. Its IUPAC name is S-pentyl 2-[(4R)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]ethanethioate.
Molecular Properties
| Compound Name | S-pentyl 2-[(4R)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]ethanethioate |
| PubChem CID | 163515140 |
| Molecular Formula | C12H20O4S |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | S-pentyl 2-[(4R)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]ethanethioate |
| SMILES | CCCCCSC(=O)C[C@H]1OC(C)(C)OC1=O |
| InChI | InChI=1S/C12H20O4S/c1-4-5-6-7-17-10(13)8-9-11(14)16-12(2,3)15-9/h9H,4-8H2,1-3H3/t9-/m1/s1 |
| InChIKey | DGAVHFGEKNWVSY-SECBINFHSA-N |
| XLogP | 2.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-pentyl 2-[(4R)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-pentyl 2-[(4R)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]ethanethioate?
The IUPAC name of S-pentyl 2-[(4R)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]ethanethioate (CID 163515140) is S-pentyl 2-[(4R)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]ethanethioate.
What is the SMILES notation for S-pentyl 2-[(4R)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]ethanethioate?
The canonical SMILES for S-pentyl 2-[(4R)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]ethanethioate is CCCCCSC(=O)C[C@H]1OC(C)(C)OC1=O.
What is the InChIKey of S-pentyl 2-[(4R)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]ethanethioate?
The InChIKey is DGAVHFGEKNWVSY-SECBINFHSA-N. The full InChI is InChI=1S/C12H20O4S/c1-4-5-6-7-17-10(13)8-9-11(14)16-12(2,3)15-9/h9H,4-8H2,1-3H3/t9-/m1/s1.
What are the key properties of S-pentyl 2-[(4R)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]ethanethioate?
S-pentyl 2-[(4R)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]ethanethioate has a molecular weight of 260.35 g/mol, XLogP of 2.50, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-pentyl 2-[(4R)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]ethanethioate is sourced from PubChem (CID 163515140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).