About (2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-oxolane]-2-yl) 2-(2,4-diazabicyclo[1.1.0]butan-1-yl)-2-iodoacetate
(2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-oxolane]-2-yl) 2-(2,4-diazabicyclo[1.1.0]butan-1-yl)-2-iodoacetate (PubChem CID 163515401) has the molecular formula C14H17IN2O4
and a molecular weight of 404.20 g/mol. Its IUPAC name is (2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-oxolane]-2-yl) 2-(2,4-diazabicyclo[1.1.0]butan-1-yl)-2-iodoacetate.
Molecular Properties
| Compound Name | (2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-oxolane]-2-yl) 2-(2,4-diazabicyclo[1.1.0]butan-1-yl)-2-iodoacetate |
| PubChem CID | 163515401 |
| Molecular Formula | C14H17IN2O4 |
| Molecular Weight | 404.20 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | (2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-oxolane]-2-yl) 2-(2,4-diazabicyclo[1.1.0]butan-1-yl)-2-iodoacetate |
| SMILES | O=C(OC1CC2CC1CC21CCOC1=O)C(I)C12NC1N2 |
| InChI | InChI=1S/C14H17IN2O4/c15-9(14-11(16-14)17-14)10(18)21-8-4-7-3-6(8)5-13(7)1-2-20-12(13)19/h6-9,11,16-17H,1-5H2 |
| InChIKey | DGHCAVCCDWVPAJ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.20 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-oxolane]-2-yl) 2-(2,4-diazabicyclo[1.1.0]butan-1-yl)-2-iodoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-oxolane]-2-yl) 2-(2,4-diazabicyclo[1.1.0]butan-1-yl)-2-iodoacetate?
The IUPAC name of (2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-oxolane]-2-yl) 2-(2,4-diazabicyclo[1.1.0]butan-1-yl)-2-iodoacetate (CID 163515401) is (2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-oxolane]-2-yl) 2-(2,4-diazabicyclo[1.1.0]butan-1-yl)-2-iodoacetate.
What is the SMILES notation for (2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-oxolane]-2-yl) 2-(2,4-diazabicyclo[1.1.0]butan-1-yl)-2-iodoacetate?
The canonical SMILES for (2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-oxolane]-2-yl) 2-(2,4-diazabicyclo[1.1.0]butan-1-yl)-2-iodoacetate is O=C(OC1CC2CC1CC21CCOC1=O)C(I)C12NC1N2.
What is the InChIKey of (2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-oxolane]-2-yl) 2-(2,4-diazabicyclo[1.1.0]butan-1-yl)-2-iodoacetate?
The InChIKey is DGHCAVCCDWVPAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17IN2O4/c15-9(14-11(16-14)17-14)10(18)21-8-4-7-3-6(8)5-13(7)1-2-20-12(13)19/h6-9,11,16-17H,1-5H2.
What are the key properties of (2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-oxolane]-2-yl) 2-(2,4-diazabicyclo[1.1.0]butan-1-yl)-2-iodoacetate?
(2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-oxolane]-2-yl) 2-(2,4-diazabicyclo[1.1.0]butan-1-yl)-2-iodoacetate has a molecular weight of 404.20 g/mol, XLogP of 0.29, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2'-oxospiro[bicyclo[2.2.1]heptane-5,3'-oxolane]-2-yl) 2-(2,4-diazabicyclo[1.1.0]butan-1-yl)-2-iodoacetate is sourced from PubChem (CID 163515401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).