About ethene;5-imino-1-(methylamino)pentan-2-one;uranium(2+)
ethene;5-imino-1-(methylamino)pentan-2-one;uranium(2+) (PubChem CID 163516563) has the molecular formula C8H14N2OU
and a molecular weight of 392.24 g/mol. Its IUPAC name is ethene;5-imino-1-(methylamino)pentan-2-one;uranium(2+).
Molecular Properties
| Compound Name | ethene;5-imino-1-(methylamino)pentan-2-one;uranium(2+) |
| PubChem CID | 163516563 |
| Molecular Formula | C8H14N2OU |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | ethene;5-imino-1-(methylamino)pentan-2-one;uranium(2+) |
| SMILES | [H]/N=[C-]/CCC(=O)CNC.[H][C-]=C.[U+2] |
| InChI | InChI=1S/C6H11N2O.C2H3.U/c1-8-5-6(9)3-2-4-7;1-2;/h7-8H,2-3,5H2,1H3;1H,2H2;/q2*-1;+2 |
| InChIKey | XKAMLJUJCFDLQY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethene;5-imino-1-(methylamino)pentan-2-one;uranium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;5-imino-1-(methylamino)pentan-2-one;uranium(2+)?
The IUPAC name of ethene;5-imino-1-(methylamino)pentan-2-one;uranium(2+) (CID 163516563) is ethene;5-imino-1-(methylamino)pentan-2-one;uranium(2+).
What is the SMILES notation for ethene;5-imino-1-(methylamino)pentan-2-one;uranium(2+)?
The canonical SMILES for ethene;5-imino-1-(methylamino)pentan-2-one;uranium(2+) is [H]/N=[C-]/CCC(=O)CNC.[H][C-]=C.[U+2].
What is the InChIKey of ethene;5-imino-1-(methylamino)pentan-2-one;uranium(2+)?
The InChIKey is XKAMLJUJCFDLQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N2O.C2H3.U/c1-8-5-6(9)3-2-4-7;1-2;/h7-8H,2-3,5H2,1H3;1H,2H2;/q2*-1;+2.
What are the key properties of ethene;5-imino-1-(methylamino)pentan-2-one;uranium(2+)?
ethene;5-imino-1-(methylamino)pentan-2-one;uranium(2+) has a molecular weight of 392.24 g/mol, XLogP of 0.69, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;5-imino-1-(methylamino)pentan-2-one;uranium(2+) is sourced from PubChem (CID 163516563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).