C36H46N3O11P — CID 163516624
methyl 2-[3-[5-[[[2-butyl-1-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]cyclopropanecarbonyl]amino]methylcarbamoyl]furan-2-yl]-5-dimethoxyphosphorylphenoxy]acetate (PubChem CID 163516624) has the molecular formula C36H46N3O11P and a molecular weight of 727.75 g/mol. Its IUPAC name is methyl 2-[3-[5-[[[2-butyl-1-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]cyclopropanecarbonyl]amino]methylcarbamoyl]furan-2-yl]-5-dimethoxyphosphorylphenoxy]acetate.
| Compound Name | methyl 2-[3-[5-[[[2-butyl-1-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]cyclopropanecarbonyl]amino]methylcarbamoyl]furan-2-yl]-5-dimethoxyphosphorylphenoxy]acetate |
|---|---|
| PubChem CID | 163516624 |
| Molecular Formula | C36H46N3O11P |
| Molecular Weight | 727.75 g/mol |
| Exact Mass | 727.29 |
| IUPAC Name | methyl 2-[3-[5-[[[2-butyl-1-[(1R)-1-[formyl(phenylmethoxy)amino]propyl]cyclopropanecarbonyl]amino]methylcarbamoyl]furan-2-yl]-5-dimethoxyphosphorylphenoxy]acetate |
| SMILES | CCCCC1CC1(C(=O)NCNC(=O)c1ccc(-c2cc(OCC(=O)OC)cc(P(=O)(OC)OC)c2)o1)C(CC)N(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H46N3O11P/c1-6-8-14-27-20-36(27,32(7-2)39(24-40)49-21-25-12-10-9-11-13-25)35(43)38-23-37-34(42)31-16-15-30(50-31)26-17-28(48-22-33(41)45-3)19-29(18-26)51(44,46-4)47-5/h9-13,15-19,24,27,32H,6-8,14,20-23H2,1-5H3,(H,37,42)(H,38,43) |
| InChIKey | DHHKSGRSFMVWJI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 171.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.75 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|