C9H13F3N4 — CID 163517413
8,9-dimethyl-3-(trifluoromethyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepine (PubChem CID 163517413) has the molecular formula C9H13F3N4 and a molecular weight of 234.22 g/mol. Its IUPAC name is 8,9-dimethyl-3-(trifluoromethyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepine.
| Compound Name | 8,9-dimethyl-3-(trifluoromethyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepine |
|---|---|
| PubChem CID | 163517413 |
| Molecular Formula | C9H13F3N4 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 8,9-dimethyl-3-(trifluoromethyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepine |
| SMILES | CC1NCCn2c(nnc2C(F)(F)F)C1C |
| InChI | InChI=1S/C9H13F3N4/c1-5-6(2)13-3-4-16-7(5)14-15-8(16)9(10,11)12/h5-6,13H,3-4H2,1-2H3 |
| InChIKey | DHXNRPRFPMYZBR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |