C8H12INO3 — CID 163518870
(E,2S)-6-amino-2-(1-hydroxyethenyl)-6-iodohex-5-enoic acid (PubChem CID 163518870) has the molecular formula C8H12INO3 and a molecular weight of 297.09 g/mol. Its IUPAC name is (E,2S)-6-amino-2-(1-hydroxyethenyl)-6-iodohex-5-enoic acid.
| Compound Name | (E,2S)-6-amino-2-(1-hydroxyethenyl)-6-iodohex-5-enoic acid |
|---|---|
| PubChem CID | 163518870 |
| Molecular Formula | C8H12INO3 |
| Molecular Weight | 297.09 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | (E,2S)-6-amino-2-(1-hydroxyethenyl)-6-iodohex-5-enoic acid |
| SMILES | C=C(O)C(CC/C=C(\N)I)C(=O)O |
| InChI | InChI=1S/C8H12INO3/c1-5(11)6(8(12)13)3-2-4-7(9)10/h4,6,11H,1-3,10H2,(H,12,13)/b7-4- |
| InChIKey | DJBLNSCTKZFKLD-DAXSKMNVSA-N |
| XLogP | 1.77 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.09 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|