(E,2S)-6-amino-2-(1-hydroxyethenyl)-6-iodohex-5-enoic acid

C8H12INO3 — CID 163518870

IUPAC(E,2S)-6-amino-2-(1-hydroxyethenyl)-6-iodohex-5-enoic acid
SMILESC=C(O)C(CC/C=C(\N)I)C(=O)O
InChIInChI=1S/C8H12INO3/c1-5(11)6(8(12)13)3-2-4-7(9)10/h4,6,11H,1-3,10H2,(H,12,13)/b7-4-
InChIKeyDJBLNSCTKZFKLD-DAXSKMNVSA-N
MW297.09 g/mol
LogP1.77
Rot. Bonds5

About (E,2S)-6-amino-2-(1-hydroxyethenyl)-6-iodohex-5-enoic acid

(E,2S)-6-amino-2-(1-hydroxyethenyl)-6-iodohex-5-enoic acid (PubChem CID 163518870) has the molecular formula C8H12INO3 and a molecular weight of 297.09 g/mol. Its IUPAC name is (E,2S)-6-amino-2-(1-hydroxyethenyl)-6-iodohex-5-enoic acid.

Molecular Properties

Compound Name(E,2S)-6-amino-2-(1-hydroxyethenyl)-6-iodohex-5-enoic acid
PubChem CID163518870
Molecular FormulaC8H12INO3
Molecular Weight297.09 g/mol
Exact Mass296.99
IUPAC Name(E,2S)-6-amino-2-(1-hydroxyethenyl)-6-iodohex-5-enoic acid
SMILESC=C(O)C(CC/C=C(\N)I)C(=O)O
InChIInChI=1S/C8H12INO3/c1-5(11)6(8(12)13)3-2-4-7(9)10/h4,6,11H,1-3,10H2,(H,12,13)/b7-4-
InChIKeyDJBLNSCTKZFKLD-DAXSKMNVSA-N
XLogP1.77
TPSA83.55 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.09
LogP ≤ 51.77
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze (E,2S)-6-amino-2-(1-hydroxyethenyl)-6-iodohex-5-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E,2S)-6-amino-2-(1-hydroxyethenyl)-6-iodohex-5-enoic acid?
The IUPAC name of (E,2S)-6-amino-2-(1-hydroxyethenyl)-6-iodohex-5-enoic acid (CID 163518870) is (E,2S)-6-amino-2-(1-hydroxyethenyl)-6-iodohex-5-enoic acid.
What is the SMILES notation for (E,2S)-6-amino-2-(1-hydroxyethenyl)-6-iodohex-5-enoic acid?
The canonical SMILES for (E,2S)-6-amino-2-(1-hydroxyethenyl)-6-iodohex-5-enoic acid is C=C(O)C(CC/C=C(\N)I)C(=O)O.
What is the InChIKey of (E,2S)-6-amino-2-(1-hydroxyethenyl)-6-iodohex-5-enoic acid?
The InChIKey is DJBLNSCTKZFKLD-DAXSKMNVSA-N. The full InChI is InChI=1S/C8H12INO3/c1-5(11)6(8(12)13)3-2-4-7(9)10/h4,6,11H,1-3,10H2,(H,12,13)/b7-4-.
What are the key properties of (E,2S)-6-amino-2-(1-hydroxyethenyl)-6-iodohex-5-enoic acid?
(E,2S)-6-amino-2-(1-hydroxyethenyl)-6-iodohex-5-enoic acid has a molecular weight of 297.09 g/mol, XLogP of 1.77, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E,2S)-6-amino-2-(1-hydroxyethenyl)-6-iodohex-5-enoic acid is sourced from PubChem (CID 163518870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).