C10H12N2O2-2 — CID 163519179
2-N,3-N-dimethyl-2-N,3-N-dioxidobicyclo[2.2.2]octa-1(6),4,7-triene-2,3-diamine (PubChem CID 163519179) has the molecular formula C10H12N2O2-2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-N,3-N-dimethyl-2-N,3-N-dioxidobicyclo[2.2.2]octa-1(6),4,7-triene-2,3-diamine.
| Compound Name | 2-N,3-N-dimethyl-2-N,3-N-dioxidobicyclo[2.2.2]octa-1(6),4,7-triene-2,3-diamine |
|---|---|
| PubChem CID | 163519179 |
| Molecular Formula | C10H12N2O2-2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-N,3-N-dimethyl-2-N,3-N-dioxidobicyclo[2.2.2]octa-1(6),4,7-triene-2,3-diamine |
| SMILES | CN([O-])C1c2ccc(cc2)C1N(C)[O-] |
| InChI | InChI=1S/C10H12N2O2/c1-11(13)9-7-3-5-8(6-4-7)10(9)12(2)14/h3-6,9-10H,1-2H3/q-2 |
| InChIKey | JSPIRHQCJKUQQX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|