C14H9F5INO — CID 163520323
5-(1,1-difluoroprop-2-enyl)-4-(iodomethyl)-2-[3-(trifluoromethyl)phenyl]-1,3-oxazole (PubChem CID 163520323) has the molecular formula C14H9F5INO and a molecular weight of 429.13 g/mol. Its IUPAC name is 5-(1,1-difluoroprop-2-enyl)-4-(iodomethyl)-2-[3-(trifluoromethyl)phenyl]-1,3-oxazole.
| Compound Name | 5-(1,1-difluoroprop-2-enyl)-4-(iodomethyl)-2-[3-(trifluoromethyl)phenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 163520323 |
| Molecular Formula | C14H9F5INO |
| Molecular Weight | 429.13 g/mol |
| Exact Mass | 428.96 |
| IUPAC Name | 5-(1,1-difluoroprop-2-enyl)-4-(iodomethyl)-2-[3-(trifluoromethyl)phenyl]-1,3-oxazole |
| SMILES | C=CC(F)(F)c1oc(-c2cccc(C(F)(F)F)c2)nc1CI |
| InChI | InChI=1S/C14H9F5INO/c1-2-13(15,16)11-10(7-20)21-12(22-11)8-4-3-5-9(6-8)14(17,18)19/h2-6H,1,7H2 |
| InChIKey | DKGPCEZNOWENDG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.13 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|