C14H23NO3 — CID 163520790
(1R)-2-[hex-5-enyl(methyl)carbamoyl]cyclopentane-1-carboxylic acid (PubChem CID 163520790) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is (1R)-2-[hex-5-enyl(methyl)carbamoyl]cyclopentane-1-carboxylic acid.
| Compound Name | (1R)-2-[hex-5-enyl(methyl)carbamoyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 163520790 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | (1R)-2-[hex-5-enyl(methyl)carbamoyl]cyclopentane-1-carboxylic acid |
| SMILES | C=CCCCCN(C)C(=O)C1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C14H23NO3/c1-3-4-5-6-10-15(2)13(16)11-8-7-9-12(11)14(17)18/h3,11-12H,1,4-10H2,2H3,(H,17,18)/t11?,12-/m1/s1 |
| InChIKey | DKPSQSKDFZAXJY-PIJUOVFKSA-N |
| XLogP | 2.30 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|