C14H17F3N2U — CID 163520838
carbanide;4-(2,5-dimethylbenzene-4-id-1-yl)-1,1,1-trifluoro-4-methyliminobut-2-en-2-amine;uranium(2+) (PubChem CID 163520838) has the molecular formula C14H17F3N2U and a molecular weight of 508.33 g/mol. Its IUPAC name is carbanide;4-(2,5-dimethylbenzene-4-id-1-yl)-1,1,1-trifluoro-4-methyliminobut-2-en-2-amine;uranium(2+).
| Compound Name | carbanide;4-(2,5-dimethylbenzene-4-id-1-yl)-1,1,1-trifluoro-4-methyliminobut-2-en-2-amine;uranium(2+) |
|---|---|
| PubChem CID | 163520838 |
| Molecular Formula | C14H17F3N2U |
| Molecular Weight | 508.33 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | carbanide;4-(2,5-dimethylbenzene-4-id-1-yl)-1,1,1-trifluoro-4-methyliminobut-2-en-2-amine;uranium(2+) |
| SMILES | C/N=C(/C=C(N)C(F)(F)F)c1cc(C)[c-]cc1C.[CH3-].[U+2] |
| InChI | InChI=1S/C13H14F3N2.CH3.U/c1-8-4-5-9(2)10(6-8)11(18-3)7-12(17)13(14,15)16;;/h5-7H,17H2,1-3H3;1H3;/q2*-1;+2/b12-7?,18-11-;; |
| InChIKey | GEXDAGCOEYIVGZ-XMYZVOHWSA-N |
| XLogP | 3.38 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|