C47H32N6 — CID 163520908
3-[3-[4-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)phenyl]phenyl]-4-phenyl-3,5,9-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),8,10,13,15-octaene (PubChem CID 163520908) has the molecular formula C47H32N6 and a molecular weight of 680.82 g/mol. Its IUPAC name is 3-[3-[4-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)phenyl]phenyl]-4-phenyl-3,5,9-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),8,10,13,15-octaene.
| Compound Name | 3-[3-[4-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)phenyl]phenyl]-4-phenyl-3,5,9-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),8,10,13,15-octaene |
|---|---|
| PubChem CID | 163520908 |
| Molecular Formula | C47H32N6 |
| Molecular Weight | 680.82 g/mol |
| Exact Mass | 680.27 |
| IUPAC Name | 3-[3-[4-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)phenyl]phenyl]-4-phenyl-3,5,9-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),8,10,13,15-octaene |
| SMILES | c1ccc(C2=NC(c3ccc(-c4cccc(-n5c(-c6ccccc6)nc6c7cnccc7c7ccccc7c65)c4)cc3)N=C(c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C47H32N6/c1-4-13-32(14-5-1)44-50-45(33-15-6-2-7-16-33)52-46(51-44)34-25-23-31(24-26-34)36-19-12-20-37(29-36)53-43-40-22-11-10-21-38(40)39-27-28-48-30-41(39)42(43)49-47(53)35-17-8-3-9-18-35/h1-30,46H,(H,50,51,52) |
| InChIKey | DKSDRKKJFAYFQG-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 67.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.82 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|