C8H12N2O2 — CID 163521365
1-N,3-N-dimethylbenzene-1,3-diamine oxide (PubChem CID 163521365) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 1-N,3-N-dimethylbenzene-1,3-diamine oxide.
| Compound Name | 1-N,3-N-dimethylbenzene-1,3-diamine oxide |
|---|---|
| PubChem CID | 163521365 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 1-N,3-N-dimethylbenzene-1,3-diamine oxide |
| SMILES | C[NH+]([O-])c1cccc([NH+](C)[O-])c1 |
| InChI | InChI=1S/C8H12N2O2/c1-9(11)7-4-3-5-8(6-7)10(2)12/h3-6,9-10H,1-2H3 |
| InChIKey | DLCKABUEKRLQAJ-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 55.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|