About CID 163521906
CID 163521906 (PubChem CID 163521906) has the molecular formula C28H25BFN3O6
and a molecular weight of 529.33 g/mol.
Molecular Properties
| Compound Name | CID 163521906 |
| PubChem CID | 163521906 |
| Molecular Formula | C28H25BFN3O6 |
| Molecular Weight | 529.33 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | — |
| SMILES | [B]c1c(Cc2ccc(F)cc2)cnc2c1N(CCN1C(=O)c3ccccc3C1O)C(=O)C(C(=O)OCC)C2O |
| InChI | InChI=1S/C28H25BFN3O6/c1-2-39-28(38)20-24(34)22-23(21(29)16(14-31-22)13-15-7-9-17(30)10-8-15)32(27(20)37)11-12-33-25(35)18-5-3-4-6-19(18)26(33)36/h3-10,14,20,24-25,34-35H,2,11-13H2,1H3 |
| InChIKey | VAECVKYVCLTYIK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 120.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 529.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 163521906 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163521906?
The IUPAC name of CID 163521906 (CID 163521906) is not available.
What is the SMILES notation for CID 163521906?
The canonical SMILES for CID 163521906 is [B]c1c(Cc2ccc(F)cc2)cnc2c1N(CCN1C(=O)c3ccccc3C1O)C(=O)C(C(=O)OCC)C2O.
What is the InChIKey of CID 163521906?
The InChIKey is VAECVKYVCLTYIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H25BFN3O6/c1-2-39-28(38)20-24(34)22-23(21(29)16(14-31-22)13-15-7-9-17(30)10-8-15)32(27(20)37)11-12-33-25(35)18-5-3-4-6-19(18)26(33)36/h3-10,14,20,24-25,34-35H,2,11-13H2,1H3.
What are the key properties of CID 163521906?
CID 163521906 has a molecular weight of 529.33 g/mol, XLogP of 1.31, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163521906 is sourced from PubChem (CID 163521906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).