About cyclohexa-2,3,4-trien-1-yl(dimethyl)sulfanium
cyclohexa-2,3,4-trien-1-yl(dimethyl)sulfanium (PubChem CID 163522331) has the molecular formula C8H11S+
and a molecular weight of 139.24 g/mol. Its IUPAC name is cyclohexa-2,3,4-trien-1-yl(dimethyl)sulfanium.
Molecular Properties
| Compound Name | cyclohexa-2,3,4-trien-1-yl(dimethyl)sulfanium |
| PubChem CID | 163522331 |
| Molecular Formula | C8H11S+ |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | cyclohexa-2,3,4-trien-1-yl(dimethyl)sulfanium |
| SMILES | C[S+](C)C1C=C=C=CC1 |
| InChI | InChI=1S/C8H11S/c1-9(2)8-6-4-3-5-7-8/h4,7-8H,6H2,1-2H3/q+1 |
| InChIKey | DLWVGSFRWJSGTC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-2,3,4-trien-1-yl(dimethyl)sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-2,3,4-trien-1-yl(dimethyl)sulfanium?
The IUPAC name of cyclohexa-2,3,4-trien-1-yl(dimethyl)sulfanium (CID 163522331) is cyclohexa-2,3,4-trien-1-yl(dimethyl)sulfanium.
What is the SMILES notation for cyclohexa-2,3,4-trien-1-yl(dimethyl)sulfanium?
The canonical SMILES for cyclohexa-2,3,4-trien-1-yl(dimethyl)sulfanium is C[S+](C)C1C=C=C=CC1.
What is the InChIKey of cyclohexa-2,3,4-trien-1-yl(dimethyl)sulfanium?
The InChIKey is DLWVGSFRWJSGTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11S/c1-9(2)8-6-4-3-5-7-8/h4,7-8H,6H2,1-2H3/q+1.
What are the key properties of cyclohexa-2,3,4-trien-1-yl(dimethyl)sulfanium?
cyclohexa-2,3,4-trien-1-yl(dimethyl)sulfanium has a molecular weight of 139.24 g/mol, XLogP of 1.50, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-2,3,4-trien-1-yl(dimethyl)sulfanium is sourced from PubChem (CID 163522331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).