C11H15F3N2O3 — CID 163522682
1-[(7R)-7-amino-5-azaspiro[2.4]heptan-5-yl]prop-2-en-1-one;2,2,2-trifluoroacetic acid (PubChem CID 163522682) has the molecular formula C11H15F3N2O3 and a molecular weight of 280.25 g/mol. Its IUPAC name is 1-[(7R)-7-amino-5-azaspiro[2.4]heptan-5-yl]prop-2-en-1-one;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(7R)-7-amino-5-azaspiro[2.4]heptan-5-yl]prop-2-en-1-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 163522682 |
| Molecular Formula | C11H15F3N2O3 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-[(7R)-7-amino-5-azaspiro[2.4]heptan-5-yl]prop-2-en-1-one;2,2,2-trifluoroacetic acid |
| SMILES | C=CC(=O)N1C[C@H](N)C2(CC2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H14N2O.C2HF3O2/c1-2-8(12)11-5-7(10)9(6-11)3-4-9;3-2(4,5)1(6)7/h2,7H,1,3-6,10H2;(H,6,7)/t7-;/m0./s1 |
| InChIKey | QGAWBPXVLZTBOF-FJXQXJEOSA-N |
| XLogP | 0.76 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|