C6H6O3 — CID 163522773
2,4,6-trimethylidene-1,3,5-trioxane (PubChem CID 163522773) has the molecular formula C6H6O3 and a molecular weight of 126.11 g/mol. Its IUPAC name is 2,4,6-trimethylidene-1,3,5-trioxane.
| Compound Name | 2,4,6-trimethylidene-1,3,5-trioxane |
|---|---|
| PubChem CID | 163522773 |
| Molecular Formula | C6H6O3 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | 2,4,6-trimethylidene-1,3,5-trioxane |
| SMILES | C=C1OC(=C)OC(=C)O1 |
| InChI | InChI=1S/C6H6O3/c1-4-7-5(2)9-6(3)8-4/h1-3H2 |
| InChIKey | DMGPYFNESSARRE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |