C27H34N2O4 — CID 163523422
(2S)-2-acetamido-N-[(2S,5R)-5-benzyl-3,6-dioxo-1-phenylhexan-2-yl]-4-methylpentanamide (PubChem CID 163523422) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is (2S)-2-acetamido-N-[(2S,5R)-5-benzyl-3,6-dioxo-1-phenylhexan-2-yl]-4-methylpentanamide.
| Compound Name | (2S)-2-acetamido-N-[(2S,5R)-5-benzyl-3,6-dioxo-1-phenylhexan-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 163523422 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | (2S)-2-acetamido-N-[(2S,5R)-5-benzyl-3,6-dioxo-1-phenylhexan-2-yl]-4-methylpentanamide |
| SMILES | CC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)C[C@H](C=O)Cc1ccccc1 |
| InChI | InChI=1S/C27H34N2O4/c1-19(2)14-25(28-20(3)31)27(33)29-24(16-22-12-8-5-9-13-22)26(32)17-23(18-30)15-21-10-6-4-7-11-21/h4-13,18-19,23-25H,14-17H2,1-3H3,(H,28,31)(H,29,33)/t23-,24+,25+/m1/s1 |
| InChIKey | BDVMNHHSVGFPCH-DSITVLBTSA-N |
| XLogP | 3.28 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|