C25H20Cl2N8O3 — CID 163524982
(2S)-2-[[4-[2-[(5-cyano-2-pyridinyl)amino]ethylamino]-6-(2,4-dichlorophenyl)pyrazolo[1,5-a]pyrazine-2-carbonyl]amino]but-3-enoic acid (PubChem CID 163524982) has the molecular formula C25H20Cl2N8O3 and a molecular weight of 551.39 g/mol. Its IUPAC name is (2S)-2-[[4-[2-[(5-cyano-2-pyridinyl)amino]ethylamino]-6-(2,4-dichlorophenyl)pyrazolo[1,5-a]pyrazine-2-carbonyl]amino]but-3-enoic acid.
| Compound Name | (2S)-2-[[4-[2-[(5-cyano-2-pyridinyl)amino]ethylamino]-6-(2,4-dichlorophenyl)pyrazolo[1,5-a]pyrazine-2-carbonyl]amino]but-3-enoic acid |
|---|---|
| PubChem CID | 163524982 |
| Molecular Formula | C25H20Cl2N8O3 |
| Molecular Weight | 551.39 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | (2S)-2-[[4-[2-[(5-cyano-2-pyridinyl)amino]ethylamino]-6-(2,4-dichlorophenyl)pyrazolo[1,5-a]pyrazine-2-carbonyl]amino]but-3-enoic acid |
| SMILES | C=C[C@H](NC(=O)c1cc2c(NCCNc3ccc(C#N)cn3)nc(-c3ccc(Cl)cc3Cl)cn2n1)C(=O)O |
| InChI | InChI=1S/C25H20Cl2N8O3/c1-2-18(25(37)38)33-24(36)19-10-21-23(30-8-7-29-22-6-3-14(11-28)12-31-22)32-20(13-35(21)34-19)16-5-4-15(26)9-17(16)27/h2-6,9-10,12-13,18H,1,7-8H2,(H,29,31)(H,30,32)(H,33,36)(H,37,38)/t18-/m0/s1 |
| InChIKey | DNZBXPCFPXQPQJ-SFHVURJKSA-N |
| XLogP | 3.86 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|