About 7H-thieno[3,2-b]pyridin-7-ide;uranium
7H-thieno[3,2-b]pyridin-7-ide;uranium (PubChem CID 163525472) has the molecular formula C7H4NSU-
and a molecular weight of 372.21 g/mol. Its IUPAC name is 7H-thieno[3,2-b]pyridin-7-ide;uranium.
Molecular Properties
| Compound Name | 7H-thieno[3,2-b]pyridin-7-ide;uranium |
| PubChem CID | 163525472 |
| Molecular Formula | C7H4NSU- |
| Molecular Weight | 372.21 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 7H-thieno[3,2-b]pyridin-7-ide;uranium |
| SMILES | [U].[c-]1ccnc2ccsc12 |
| InChI | InChI=1S/C7H4NS.U/c1-2-7-6(8-4-1)3-5-9-7;/h1,3-5H;/q-1; |
| InChIKey | HCKOCZXZCZZBAD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 7H-thieno[3,2-b]pyridin-7-ide;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-thieno[3,2-b]pyridin-7-ide;uranium?
The IUPAC name of 7H-thieno[3,2-b]pyridin-7-ide;uranium (CID 163525472) is 7H-thieno[3,2-b]pyridin-7-ide;uranium.
What is the SMILES notation for 7H-thieno[3,2-b]pyridin-7-ide;uranium?
The canonical SMILES for 7H-thieno[3,2-b]pyridin-7-ide;uranium is [U].[c-]1ccnc2ccsc12.
What is the InChIKey of 7H-thieno[3,2-b]pyridin-7-ide;uranium?
The InChIKey is HCKOCZXZCZZBAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4NS.U/c1-2-7-6(8-4-1)3-5-9-7;/h1,3-5H;/q-1;.
What are the key properties of 7H-thieno[3,2-b]pyridin-7-ide;uranium?
7H-thieno[3,2-b]pyridin-7-ide;uranium has a molecular weight of 372.21 g/mol, XLogP of 2.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-thieno[3,2-b]pyridin-7-ide;uranium is sourced from PubChem (CID 163525472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).