About 2-[3-(1-ethylcyclopentyl)oxy-2-methyl-3-oxopropoxy]-1,1-difluoroethanesulfonic acid
2-[3-(1-ethylcyclopentyl)oxy-2-methyl-3-oxopropoxy]-1,1-difluoroethanesulfonic acid (PubChem CID 163525602) has the molecular formula C13H22F2O6S
and a molecular weight of 344.38 g/mol. Its IUPAC name is 2-[3-(1-ethylcyclopentyl)oxy-2-methyl-3-oxopropoxy]-1,1-difluoroethanesulfonic acid.
Molecular Properties
| Compound Name | 2-[3-(1-ethylcyclopentyl)oxy-2-methyl-3-oxopropoxy]-1,1-difluoroethanesulfonic acid |
| PubChem CID | 163525602 |
| Molecular Formula | C13H22F2O6S |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2-[3-(1-ethylcyclopentyl)oxy-2-methyl-3-oxopropoxy]-1,1-difluoroethanesulfonic acid |
| SMILES | CCC1(OC(=O)C(C)COCC(F)(F)S(=O)(=O)O)CCCC1 |
| InChI | InChI=1S/C13H22F2O6S/c1-3-12(6-4-5-7-12)21-11(16)10(2)8-20-9-13(14,15)22(17,18)19/h10H,3-9H2,1-2H3,(H,17,18,19) |
| InChIKey | DOMNEYCQYKVIQD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(1-ethylcyclopentyl)oxy-2-methyl-3-oxopropoxy]-1,1-difluoroethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(1-ethylcyclopentyl)oxy-2-methyl-3-oxopropoxy]-1,1-difluoroethanesulfonic acid?
The IUPAC name of 2-[3-(1-ethylcyclopentyl)oxy-2-methyl-3-oxopropoxy]-1,1-difluoroethanesulfonic acid (CID 163525602) is 2-[3-(1-ethylcyclopentyl)oxy-2-methyl-3-oxopropoxy]-1,1-difluoroethanesulfonic acid.
What is the SMILES notation for 2-[3-(1-ethylcyclopentyl)oxy-2-methyl-3-oxopropoxy]-1,1-difluoroethanesulfonic acid?
The canonical SMILES for 2-[3-(1-ethylcyclopentyl)oxy-2-methyl-3-oxopropoxy]-1,1-difluoroethanesulfonic acid is CCC1(OC(=O)C(C)COCC(F)(F)S(=O)(=O)O)CCCC1.
What is the InChIKey of 2-[3-(1-ethylcyclopentyl)oxy-2-methyl-3-oxopropoxy]-1,1-difluoroethanesulfonic acid?
The InChIKey is DOMNEYCQYKVIQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22F2O6S/c1-3-12(6-4-5-7-12)21-11(16)10(2)8-20-9-13(14,15)22(17,18)19/h10H,3-9H2,1-2H3,(H,17,18,19).
What are the key properties of 2-[3-(1-ethylcyclopentyl)oxy-2-methyl-3-oxopropoxy]-1,1-difluoroethanesulfonic acid?
2-[3-(1-ethylcyclopentyl)oxy-2-methyl-3-oxopropoxy]-1,1-difluoroethanesulfonic acid has a molecular weight of 344.38 g/mol, XLogP of 2.39, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1-ethylcyclopentyl)oxy-2-methyl-3-oxopropoxy]-1,1-difluoroethanesulfonic acid is sourced from PubChem (CID 163525602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).