C11H18O — CID 163526044
(3S,3aR,4R,7aS)-3,7-dimethyl-2,3,3a,4,5,7a-hexahydro-1H-inden-4-ol (PubChem CID 163526044) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (3S,3aR,4R,7aS)-3,7-dimethyl-2,3,3a,4,5,7a-hexahydro-1H-inden-4-ol.
| Compound Name | (3S,3aR,4R,7aS)-3,7-dimethyl-2,3,3a,4,5,7a-hexahydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 163526044 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (3S,3aR,4R,7aS)-3,7-dimethyl-2,3,3a,4,5,7a-hexahydro-1H-inden-4-ol |
| SMILES | CC1=CC[C@@H](O)[C@H]2[C@@H]1CC[C@@H]2C |
| InChI | InChI=1S/C11H18O/c1-7-4-6-10(12)11-8(2)3-5-9(7)11/h4,8-12H,3,5-6H2,1-2H3/t8-,9+,10+,11+/m0/s1 |
| InChIKey | DOVRZZRTLYQXCS-LNFKQOIKSA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|