About 1-(4-amino-3-methoxy-1-methylcyclohexa-2,4-dien-1-yl)-N,N-dimethylpiperidin-4-amine
1-(4-amino-3-methoxy-1-methylcyclohexa-2,4-dien-1-yl)-N,N-dimethylpiperidin-4-amine (PubChem CID 163526631) has the molecular formula C15H27N3O
and a molecular weight of 265.40 g/mol. Its IUPAC name is 1-(4-amino-3-methoxy-1-methylcyclohexa-2,4-dien-1-yl)-N,N-dimethylpiperidin-4-amine.
Molecular Properties
| Compound Name | 1-(4-amino-3-methoxy-1-methylcyclohexa-2,4-dien-1-yl)-N,N-dimethylpiperidin-4-amine |
| PubChem CID | 163526631 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | 1-(4-amino-3-methoxy-1-methylcyclohexa-2,4-dien-1-yl)-N,N-dimethylpiperidin-4-amine |
| SMILES | COC1=CC(C)(N2CCC(N(C)C)CC2)CC=C1N |
| InChI | InChI=1S/C15H27N3O/c1-15(8-5-13(16)14(11-15)19-4)18-9-6-12(7-10-18)17(2)3/h5,11-12H,6-10,16H2,1-4H3 |
| InChIKey | DPIILFWAFVGIMD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-amino-3-methoxy-1-methylcyclohexa-2,4-dien-1-yl)-N,N-dimethylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-3-methoxy-1-methylcyclohexa-2,4-dien-1-yl)-N,N-dimethylpiperidin-4-amine?
The IUPAC name of 1-(4-amino-3-methoxy-1-methylcyclohexa-2,4-dien-1-yl)-N,N-dimethylpiperidin-4-amine (CID 163526631) is 1-(4-amino-3-methoxy-1-methylcyclohexa-2,4-dien-1-yl)-N,N-dimethylpiperidin-4-amine.
What is the SMILES notation for 1-(4-amino-3-methoxy-1-methylcyclohexa-2,4-dien-1-yl)-N,N-dimethylpiperidin-4-amine?
The canonical SMILES for 1-(4-amino-3-methoxy-1-methylcyclohexa-2,4-dien-1-yl)-N,N-dimethylpiperidin-4-amine is COC1=CC(C)(N2CCC(N(C)C)CC2)CC=C1N.
What is the InChIKey of 1-(4-amino-3-methoxy-1-methylcyclohexa-2,4-dien-1-yl)-N,N-dimethylpiperidin-4-amine?
The InChIKey is DPIILFWAFVGIMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N3O/c1-15(8-5-13(16)14(11-15)19-4)18-9-6-12(7-10-18)17(2)3/h5,11-12H,6-10,16H2,1-4H3.
What are the key properties of 1-(4-amino-3-methoxy-1-methylcyclohexa-2,4-dien-1-yl)-N,N-dimethylpiperidin-4-amine?
1-(4-amino-3-methoxy-1-methylcyclohexa-2,4-dien-1-yl)-N,N-dimethylpiperidin-4-amine has a molecular weight of 265.40 g/mol, XLogP of 1.55, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-3-methoxy-1-methylcyclohexa-2,4-dien-1-yl)-N,N-dimethylpiperidin-4-amine is sourced from PubChem (CID 163526631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).