C29H25F3N2O5S — CID 163527006
methyl 2,7-dimethyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylate (PubChem CID 163527006) has the molecular formula C29H25F3N2O5S and a molecular weight of 570.59 g/mol. Its IUPAC name is methyl 2,7-dimethyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylate.
| Compound Name | methyl 2,7-dimethyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylate |
|---|---|
| PubChem CID | 163527006 |
| Molecular Formula | C29H25F3N2O5S |
| Molecular Weight | 570.59 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | methyl 2,7-dimethyl-8-(naphthalen-1-ylmethyl)-1,1,6-trioxo-9-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrido[1,2-e][1,2,5]thiadiazine-4-carboxylate |
| SMILES | COC(=O)C1CN(C)S(=O)(=O)c2c(-c3cccc(C(F)(F)F)c3)c(Cc3cccc4ccccc34)c(C)c(=O)n21 |
| InChI | InChI=1S/C29H25F3N2O5S/c1-17-23(15-19-10-6-9-18-8-4-5-13-22(18)19)25(20-11-7-12-21(14-20)29(30,31)32)27-34(26(17)35)24(28(36)39-3)16-33(2)40(27,37)38/h4-14,24H,15-16H2,1-3H3 |
| InChIKey | DPQLAMNLRODGCT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |