C15H22BrClO — CID 163527134
(3S)-2-[2-(4-bromo-3-chlorophenyl)propan-2-yl]-3-methylpentan-1-ol (PubChem CID 163527134) has the molecular formula C15H22BrClO and a molecular weight of 333.70 g/mol. Its IUPAC name is (3S)-2-[2-(4-bromo-3-chlorophenyl)propan-2-yl]-3-methylpentan-1-ol.
| Compound Name | (3S)-2-[2-(4-bromo-3-chlorophenyl)propan-2-yl]-3-methylpentan-1-ol |
|---|---|
| PubChem CID | 163527134 |
| Molecular Formula | C15H22BrClO |
| Molecular Weight | 333.70 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | (3S)-2-[2-(4-bromo-3-chlorophenyl)propan-2-yl]-3-methylpentan-1-ol |
| SMILES | CC[C@H](C)C(CO)C(C)(C)c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C15H22BrClO/c1-5-10(2)12(9-18)15(3,4)11-6-7-13(16)14(17)8-11/h6-8,10,12,18H,5,9H2,1-4H3/t10-,12?/m0/s1 |
| InChIKey | ZGVNLGZXGRMRIL-NUHJPDEHSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.70 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |