C8H14N4 — CID 163527698
6-propyl-2,5,6,9-tetrahydro-1H-purine (PubChem CID 163527698) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is 6-propyl-2,5,6,9-tetrahydro-1H-purine.
| Compound Name | 6-propyl-2,5,6,9-tetrahydro-1H-purine |
|---|---|
| PubChem CID | 163527698 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 6-propyl-2,5,6,9-tetrahydro-1H-purine |
| SMILES | CCCC1NCN=C2NC=NC21 |
| InChI | InChI=1S/C8H14N4/c1-2-3-6-7-8(11-4-9-6)12-5-10-7/h5-7,9H,2-4H2,1H3,(H,10,11,12) |
| InChIKey | DQEJMLBPUZMJGY-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |