C23H26N2O — CID 163527858
N-benzyl-1-cyclohexyl-3,4-dihydroisoquinoline-7-carboxamide (PubChem CID 163527858) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is N-benzyl-1-cyclohexyl-3,4-dihydroisoquinoline-7-carboxamide.
| Compound Name | N-benzyl-1-cyclohexyl-3,4-dihydroisoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 163527858 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N-benzyl-1-cyclohexyl-3,4-dihydroisoquinoline-7-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1ccc2c(c1)C(C1CCCCC1)=NCC2 |
| InChI | InChI=1S/C23H26N2O/c26-23(25-16-17-7-3-1-4-8-17)20-12-11-18-13-14-24-22(21(18)15-20)19-9-5-2-6-10-19/h1,3-4,7-8,11-12,15,19H,2,5-6,9-10,13-14,16H2,(H,25,26) |
| InChIKey | DQHYMGQHBPHXBT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |