C10H18NO+ — CID 163529506
[hydroxy-(2,4,6-trimethylcyclohexa-2,4-dien-1-yl)methyl]azanium (PubChem CID 163529506) has the molecular formula C10H18NO+ and a molecular weight of 168.26 g/mol. Its IUPAC name is [hydroxy-(2,4,6-trimethylcyclohexa-2,4-dien-1-yl)methyl]azanium.
| Compound Name | [hydroxy-(2,4,6-trimethylcyclohexa-2,4-dien-1-yl)methyl]azanium |
|---|---|
| PubChem CID | 163529506 |
| Molecular Formula | C10H18NO+ |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | [hydroxy-(2,4,6-trimethylcyclohexa-2,4-dien-1-yl)methyl]azanium |
| SMILES | CC1=CC(C)C(C([NH3+])O)C(C)=C1 |
| InChI | InChI=1S/C10H17NO/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4-5,7,9-10,12H,11H2,1-3H3/p+1 |
| InChIKey | DRRXGTLIAFDIOH-UHFFFAOYSA-O |
| XLogP | 0.71 |
| TPSA | 47.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|