C18H29O2S+ — CID 163530015
[4-(oxan-2-yloxymethyl)phenyl]-di(propan-2-yl)sulfanium (PubChem CID 163530015) has the molecular formula C18H29O2S+ and a molecular weight of 309.49 g/mol. Its IUPAC name is [4-(oxan-2-yloxymethyl)phenyl]-di(propan-2-yl)sulfanium.
| Compound Name | [4-(oxan-2-yloxymethyl)phenyl]-di(propan-2-yl)sulfanium |
|---|---|
| PubChem CID | 163530015 |
| Molecular Formula | C18H29O2S+ |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | [4-(oxan-2-yloxymethyl)phenyl]-di(propan-2-yl)sulfanium |
| SMILES | CC(C)[S+](c1ccc(COC2CCCCO2)cc1)C(C)C |
| InChI | InChI=1S/C18H29O2S/c1-14(2)21(15(3)4)17-10-8-16(9-11-17)13-20-18-7-5-6-12-19-18/h8-11,14-15,18H,5-7,12-13H2,1-4H3/q+1 |
| InChIKey | DSDRFFWFPASFRQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|