C20H31IO4 — CID 163530297
(5S,7R,8S,9S,10S,12S,13S,14R)-7,12-dihydroxy-14-iodo-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carboxylic acid (PubChem CID 163530297) has the molecular formula C20H31IO4 and a molecular weight of 462.37 g/mol. Its IUPAC name is (5S,7R,8S,9S,10S,12S,13S,14R)-7,12-dihydroxy-14-iodo-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carboxylic acid.
| Compound Name | (5S,7R,8S,9S,10S,12S,13S,14R)-7,12-dihydroxy-14-iodo-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
|---|---|
| PubChem CID | 163530297 |
| Molecular Formula | C20H31IO4 |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | (5S,7R,8S,9S,10S,12S,13S,14R)-7,12-dihydroxy-14-iodo-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
| SMILES | C[C@]12CCCC[C@H]1C[C@@H](O)[C@@H]1[C@@H]2C[C@H](O)[C@]2(C)C(C(=O)O)CC[C@@]12I |
| InChI | InChI=1S/C20H31IO4/c1-18-7-4-3-5-11(18)9-14(22)16-13(18)10-15(23)19(2)12(17(24)25)6-8-20(16,19)21/h11-16,22-23H,3-10H2,1-2H3,(H,24,25)/t11-,12?,13-,14+,15-,16-,18-,19-,20+/m0/s1 |
| InChIKey | DSKJYFRFZYABPT-ALWKZHJISA-N |
| XLogP | 3.62 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|