C20H38N2 — CID 163531661
3-propan-2-yl-3-azabicyclo[3.2.1]octane;8-propan-2-yl-8-azabicyclo[3.2.1]octane (PubChem CID 163531661) has the molecular formula C20H38N2 and a molecular weight of 306.54 g/mol. Its IUPAC name is 3-propan-2-yl-3-azabicyclo[3.2.1]octane;8-propan-2-yl-8-azabicyclo[3.2.1]octane.
| Compound Name | 3-propan-2-yl-3-azabicyclo[3.2.1]octane;8-propan-2-yl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 163531661 |
| Molecular Formula | C20H38N2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.30 |
| IUPAC Name | 3-propan-2-yl-3-azabicyclo[3.2.1]octane;8-propan-2-yl-8-azabicyclo[3.2.1]octane |
| SMILES | CC(C)N1C2CCCC1CC2.CC(C)N1CC2CCC(C2)C1 |
| InChI | InChI=1S/2C10H19N/c1-8(2)11-6-9-3-4-10(5-9)7-11;1-8(2)11-9-4-3-5-10(11)7-6-9/h2*8-10H,3-7H2,1-2H3 |
| InChIKey | DTNBLFFLOVVNGH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |