C14H14BrNO2 — CID 163532406
methyl 2-(4-bromoanilino)cyclohexa-1,3-diene-1-carboxylate (PubChem CID 163532406) has the molecular formula C14H14BrNO2 and a molecular weight of 308.18 g/mol. Its IUPAC name is methyl 2-(4-bromoanilino)cyclohexa-1,3-diene-1-carboxylate.
| Compound Name | methyl 2-(4-bromoanilino)cyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 163532406 |
| Molecular Formula | C14H14BrNO2 |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | methyl 2-(4-bromoanilino)cyclohexa-1,3-diene-1-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccc(Br)cc2)C=CCC1 |
| InChI | InChI=1S/C14H14BrNO2/c1-18-14(17)12-4-2-3-5-13(12)16-11-8-6-10(15)7-9-11/h3,5-9,16H,2,4H2,1H3 |
| InChIKey | DUCCHXLYZLLCRY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |