C34H48N4O2 — CID 163532654
3-[(3S)-3-[[(4R)-2-amino-4-(2-cyclohexylethyl)-1-methyl-5-oxoimidazol-4-yl]methyl]cyclohexyl]-2-methyl-N-naphthalen-2-ylbutanamide (PubChem CID 163532654) has the molecular formula C34H48N4O2 and a molecular weight of 544.78 g/mol. Its IUPAC name is 3-[(3S)-3-[[(4R)-2-amino-4-(2-cyclohexylethyl)-1-methyl-5-oxoimidazol-4-yl]methyl]cyclohexyl]-2-methyl-N-naphthalen-2-ylbutanamide.
| Compound Name | 3-[(3S)-3-[[(4R)-2-amino-4-(2-cyclohexylethyl)-1-methyl-5-oxoimidazol-4-yl]methyl]cyclohexyl]-2-methyl-N-naphthalen-2-ylbutanamide |
|---|---|
| PubChem CID | 163532654 |
| Molecular Formula | C34H48N4O2 |
| Molecular Weight | 544.78 g/mol |
| Exact Mass | 544.38 |
| IUPAC Name | 3-[(3S)-3-[[(4R)-2-amino-4-(2-cyclohexylethyl)-1-methyl-5-oxoimidazol-4-yl]methyl]cyclohexyl]-2-methyl-N-naphthalen-2-ylbutanamide |
| SMILES | CC(C(=O)Nc1ccc2ccccc2c1)C(C)C1CCC[C@H](C[C@@]2(CCC3CCCCC3)N=C(N)N(C)C2=O)C1 |
| InChI | InChI=1S/C34H48N4O2/c1-23(24(2)31(39)36-30-17-16-27-13-7-8-14-29(27)21-30)28-15-9-12-26(20-28)22-34(32(40)38(3)33(35)37-34)19-18-25-10-5-4-6-11-25/h7-8,13-14,16-17,21,23-26,28H,4-6,9-12,15,18-20,22H2,1-3H3,(H2,35,37)(H,36,39)/t23?,24?,26-,28?,34+/m0/s1 |
| InChIKey | DUHWMYFQDBUPKL-SINLHKJGSA-N |
| XLogP | 7.13 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.78 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |