About 4-bromocyclohexa-2,4-diene-1-sulfonic acid
4-bromocyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 163532712) has the molecular formula C6H7BrO3S
and a molecular weight of 239.09 g/mol. Its IUPAC name is 4-bromocyclohexa-2,4-diene-1-sulfonic acid.
Molecular Properties
| Compound Name | 4-bromocyclohexa-2,4-diene-1-sulfonic acid |
| PubChem CID | 163532712 |
| Molecular Formula | C6H7BrO3S |
| Molecular Weight | 239.09 g/mol |
| Exact Mass | 237.93 |
| IUPAC Name | 4-bromocyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | O=S(=O)(O)C1C=CC(Br)=CC1 |
| InChI | InChI=1S/C6H7BrO3S/c7-5-1-3-6(4-2-5)11(8,9)10/h1-3,6H,4H2,(H,8,9,10) |
| InChIKey | DUJASXPCOLTCPO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.09 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-bromocyclohexa-2,4-diene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromocyclohexa-2,4-diene-1-sulfonic acid?
The IUPAC name of 4-bromocyclohexa-2,4-diene-1-sulfonic acid (CID 163532712) is 4-bromocyclohexa-2,4-diene-1-sulfonic acid.
What is the SMILES notation for 4-bromocyclohexa-2,4-diene-1-sulfonic acid?
The canonical SMILES for 4-bromocyclohexa-2,4-diene-1-sulfonic acid is O=S(=O)(O)C1C=CC(Br)=CC1.
What is the InChIKey of 4-bromocyclohexa-2,4-diene-1-sulfonic acid?
The InChIKey is DUJASXPCOLTCPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BrO3S/c7-5-1-3-6(4-2-5)11(8,9)10/h1-3,6H,4H2,(H,8,9,10).
What are the key properties of 4-bromocyclohexa-2,4-diene-1-sulfonic acid?
4-bromocyclohexa-2,4-diene-1-sulfonic acid has a molecular weight of 239.09 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromocyclohexa-2,4-diene-1-sulfonic acid is sourced from PubChem (CID 163532712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).