About 1-N-[(1R)-1-fluoroethyl]-2,2-dimethylpentane-1,4-diamine
1-N-[(1R)-1-fluoroethyl]-2,2-dimethylpentane-1,4-diamine (PubChem CID 163532861) has the molecular formula C9H21FN2
and a molecular weight of 176.28 g/mol. Its IUPAC name is 1-N-[(1R)-1-fluoroethyl]-2,2-dimethylpentane-1,4-diamine.
Molecular Properties
| Compound Name | 1-N-[(1R)-1-fluoroethyl]-2,2-dimethylpentane-1,4-diamine |
| PubChem CID | 163532861 |
| Molecular Formula | C9H21FN2 |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.17 |
| IUPAC Name | 1-N-[(1R)-1-fluoroethyl]-2,2-dimethylpentane-1,4-diamine |
| SMILES | CC(N)CC(C)(C)CN[C@@H](C)F |
| InChI | InChI=1S/C9H21FN2/c1-7(11)5-9(3,4)6-12-8(2)10/h7-8,12H,5-6,11H2,1-4H3/t7?,8-/m0/s1 |
| InChIKey | VVJCXHLZWJCPRQ-MQWKRIRWSA-N |
| XLogP | 1.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-N-[(1R)-1-fluoroethyl]-2,2-dimethylpentane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-[(1R)-1-fluoroethyl]-2,2-dimethylpentane-1,4-diamine?
The IUPAC name of 1-N-[(1R)-1-fluoroethyl]-2,2-dimethylpentane-1,4-diamine (CID 163532861) is 1-N-[(1R)-1-fluoroethyl]-2,2-dimethylpentane-1,4-diamine.
What is the SMILES notation for 1-N-[(1R)-1-fluoroethyl]-2,2-dimethylpentane-1,4-diamine?
The canonical SMILES for 1-N-[(1R)-1-fluoroethyl]-2,2-dimethylpentane-1,4-diamine is CC(N)CC(C)(C)CN[C@@H](C)F.
What is the InChIKey of 1-N-[(1R)-1-fluoroethyl]-2,2-dimethylpentane-1,4-diamine?
The InChIKey is VVJCXHLZWJCPRQ-MQWKRIRWSA-N. The full InChI is InChI=1S/C9H21FN2/c1-7(11)5-9(3,4)6-12-8(2)10/h7-8,12H,5-6,11H2,1-4H3/t7?,8-/m0/s1.
What are the key properties of 1-N-[(1R)-1-fluoroethyl]-2,2-dimethylpentane-1,4-diamine?
1-N-[(1R)-1-fluoroethyl]-2,2-dimethylpentane-1,4-diamine has a molecular weight of 176.28 g/mol, XLogP of 1.65, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-[(1R)-1-fluoroethyl]-2,2-dimethylpentane-1,4-diamine is sourced from PubChem (CID 163532861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).