C8H14N2O2-2 — CID 163532969
1-N,3-N-dimethyl-1-N,3-N-dioxidocyclohex-3-ene-1,3-diamine (PubChem CID 163532969) has the molecular formula C8H14N2O2-2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 1-N,3-N-dimethyl-1-N,3-N-dioxidocyclohex-3-ene-1,3-diamine.
| Compound Name | 1-N,3-N-dimethyl-1-N,3-N-dioxidocyclohex-3-ene-1,3-diamine |
|---|---|
| PubChem CID | 163532969 |
| Molecular Formula | C8H14N2O2-2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 1-N,3-N-dimethyl-1-N,3-N-dioxidocyclohex-3-ene-1,3-diamine |
| SMILES | CN([O-])C1=CCCC(N(C)[O-])C1 |
| InChI | InChI=1S/C8H14N2O2/c1-9(11)7-4-3-5-8(6-7)10(2)12/h4,8H,3,5-6H2,1-2H3/q-2 |
| InChIKey | RHJOJEPGWBRWII-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|