C17H18O5 — CID 163533106
(1S,3R,4R,5R,9R)-4,5,11-trihydroxy-12-methoxypentacyclo[7.6.1.01,3.04,9.010,15]hexadeca-10(15),11,13-trien-7-one (PubChem CID 163533106) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is (1S,3R,4R,5R,9R)-4,5,11-trihydroxy-12-methoxypentacyclo[7.6.1.01,3.04,9.010,15]hexadeca-10(15),11,13-trien-7-one.
| Compound Name | (1S,3R,4R,5R,9R)-4,5,11-trihydroxy-12-methoxypentacyclo[7.6.1.01,3.04,9.010,15]hexadeca-10(15),11,13-trien-7-one |
|---|---|
| PubChem CID | 163533106 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (1S,3R,4R,5R,9R)-4,5,11-trihydroxy-12-methoxypentacyclo[7.6.1.01,3.04,9.010,15]hexadeca-10(15),11,13-trien-7-one |
| SMILES | COc1ccc2c(c1O)[C@@]13CC(=O)C[C@@H](O)[C@@]1(O)[C@@H]1C[C@@]21C3 |
| InChI | InChI=1S/C17H18O5/c1-22-10-3-2-9-13(14(10)20)16-5-8(18)4-12(19)17(16,21)11-6-15(9,11)7-16/h2-3,11-12,19-21H,4-7H2,1H3/t11-,12-,15-,16+,17+/m1/s1 |
| InChIKey | DUQYXLFVFXQKQA-FBHBFLDISA-N |
| XLogP | 0.77 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |