About 7-ethyl-4,8-dihydro-3H-quinazolin-2-one
7-ethyl-4,8-dihydro-3H-quinazolin-2-one (PubChem CID 163534285) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 7-ethyl-4,8-dihydro-3H-quinazolin-2-one.
Molecular Properties
| Compound Name | 7-ethyl-4,8-dihydro-3H-quinazolin-2-one |
| PubChem CID | 163534285 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 7-ethyl-4,8-dihydro-3H-quinazolin-2-one |
| SMILES | CCC1=CC=C2CNC(=O)N=C2C1 |
| InChI | InChI=1S/C10H12N2O/c1-2-7-3-4-8-6-11-10(13)12-9(8)5-7/h3-4H,2,5-6H2,1H3,(H,11,13) |
| InChIKey | DVQBDEZNEJLSKP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-ethyl-4,8-dihydro-3H-quinazolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-4,8-dihydro-3H-quinazolin-2-one?
The IUPAC name of 7-ethyl-4,8-dihydro-3H-quinazolin-2-one (CID 163534285) is 7-ethyl-4,8-dihydro-3H-quinazolin-2-one.
What is the SMILES notation for 7-ethyl-4,8-dihydro-3H-quinazolin-2-one?
The canonical SMILES for 7-ethyl-4,8-dihydro-3H-quinazolin-2-one is CCC1=CC=C2CNC(=O)N=C2C1.
What is the InChIKey of 7-ethyl-4,8-dihydro-3H-quinazolin-2-one?
The InChIKey is DVQBDEZNEJLSKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-2-7-3-4-8-6-11-10(13)12-9(8)5-7/h3-4H,2,5-6H2,1H3,(H,11,13).
What are the key properties of 7-ethyl-4,8-dihydro-3H-quinazolin-2-one?
7-ethyl-4,8-dihydro-3H-quinazolin-2-one has a molecular weight of 176.22 g/mol, XLogP of 1.82, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-4,8-dihydro-3H-quinazolin-2-one is sourced from PubChem (CID 163534285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).